C13H11Br3N2OS — CID 66386124
N-[2-[(2,4,6-tribromoanilino)methyl]thiophen-3-yl]acetamide (PubChem CID 66386124) has the molecular formula C13H11Br3N2OS and a molecular weight of 483.02 g/mol. Its IUPAC name is N-[2-[(2,4,6-tribromoanilino)methyl]thiophen-3-yl]acetamide.
| Compound Name | N-[2-[(2,4,6-tribromoanilino)methyl]thiophen-3-yl]acetamide |
|---|---|
| PubChem CID | 66386124 |
| Molecular Formula | C13H11Br3N2OS |
| Molecular Weight | 483.02 g/mol |
| Exact Mass | 479.81 |
| IUPAC Name | N-[2-[(2,4,6-tribromoanilino)methyl]thiophen-3-yl]acetamide |
| SMILES | CC(=O)Nc1ccsc1CNc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C13H11Br3N2OS/c1-7(19)18-11-2-3-20-12(11)6-17-13-9(15)4-8(14)5-10(13)16/h2-5,17H,6H2,1H3,(H,18,19) |
| InChIKey | FCCNXMNTCGDZHB-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.02 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |