C14H16FNO2 — CID 66393471
1-[3-fluoro-4-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)phenyl]ethanone (PubChem CID 66393471) has the molecular formula C14H16FNO2 and a molecular weight of 249.28 g/mol. Its IUPAC name is 1-[3-fluoro-4-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)phenyl]ethanone.
| Compound Name | 1-[3-fluoro-4-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)phenyl]ethanone |
|---|---|
| PubChem CID | 66393471 |
| Molecular Formula | C14H16FNO2 |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 1-[3-fluoro-4-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)phenyl]ethanone |
| SMILES | CC(=O)c1ccc(N2CC3CCC(C2)O3)c(F)c1 |
| InChI | InChI=1S/C14H16FNO2/c1-9(17)10-2-5-14(13(15)6-10)16-7-11-3-4-12(8-16)18-11/h2,5-6,11-12H,3-4,7-8H2,1H3 |
| InChIKey | YNRFAYKYQABBST-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |