C17H22FNO2 — CID 81095824
1-[4-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-3-fluorophenyl]ethanone (PubChem CID 81095824) has the molecular formula C17H22FNO2 and a molecular weight of 291.37 g/mol. Its IUPAC name is 1-[4-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-3-fluorophenyl]ethanone.
| Compound Name | 1-[4-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-3-fluorophenyl]ethanone |
|---|---|
| PubChem CID | 81095824 |
| Molecular Formula | C17H22FNO2 |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 1-[4-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-3-fluorophenyl]ethanone |
| SMILES | CC(=O)c1ccc(N2CCC3(O)CCCCC3C2)c(F)c1 |
| InChI | InChI=1S/C17H22FNO2/c1-12(20)13-5-6-16(15(18)10-13)19-9-8-17(21)7-3-2-4-14(17)11-19/h5-6,10,14,21H,2-4,7-9,11H2,1H3 |
| InChIKey | OKGWUWFEGJJSTH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |