C16H22N2O3 — CID 81108525
4-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-3-aminobenzoic acid (PubChem CID 81108525) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 4-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-3-aminobenzoic acid.
| Compound Name | 4-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-3-aminobenzoic acid |
|---|---|
| PubChem CID | 81108525 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 4-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-3-aminobenzoic acid |
| SMILES | Nc1cc(C(=O)O)ccc1N1CCC2(O)CCCCC2C1 |
| InChI | InChI=1S/C16H22N2O3/c17-13-9-11(15(19)20)4-5-14(13)18-8-7-16(21)6-2-1-3-12(16)10-18/h4-5,9,12,21H,1-3,6-8,10,17H2,(H,19,20) |
| InChIKey | AMWIJIQKBVRSED-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|