C17H15NO2S — CID 66394215
N-[[4-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]bicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide (PubChem CID 66394215) has the molecular formula C17H15NO2S and a molecular weight of 297.38 g/mol. Its IUPAC name is N-[[4-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]bicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide.
| Compound Name | N-[[4-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]bicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide |
|---|---|
| PubChem CID | 66394215 |
| Molecular Formula | C17H15NO2S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | N-[[4-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]bicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide |
| SMILES | O=C(NCc1cc(C#CCO)cs1)C1Cc2ccccc21 |
| InChI | InChI=1S/C17H15NO2S/c19-7-3-4-12-8-14(21-11-12)10-18-17(20)16-9-13-5-1-2-6-15(13)16/h1-2,5-6,8,11,16,19H,7,9-10H2,(H,18,20) |
| InChIKey | BBUTTXSZUWLOLB-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|