C13H23NO — CID 66397815
[1-(2-ethylhexyl)pyrrol-2-yl]methanol (PubChem CID 66397815) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is [1-(2-ethylhexyl)pyrrol-2-yl]methanol.
| Compound Name | [1-(2-ethylhexyl)pyrrol-2-yl]methanol |
|---|---|
| PubChem CID | 66397815 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | [1-(2-ethylhexyl)pyrrol-2-yl]methanol |
| SMILES | CCCCC(CC)Cn1cccc1CO |
| InChI | InChI=1S/C13H23NO/c1-3-5-7-12(4-2)10-14-9-6-8-13(14)11-15/h6,8-9,12,15H,3-5,7,10-11H2,1-2H3 |
| InChIKey | MOTKZBSJQJEVCZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |