C12H20N2O2 — CID 66399382
methyl (2S)-3-methyl-2-[(1-methylpyrrol-3-yl)methylamino]butanoate (PubChem CID 66399382) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is methyl (2S)-3-methyl-2-[(1-methylpyrrol-3-yl)methylamino]butanoate.
| Compound Name | methyl (2S)-3-methyl-2-[(1-methylpyrrol-3-yl)methylamino]butanoate |
|---|---|
| PubChem CID | 66399382 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | methyl (2S)-3-methyl-2-[(1-methylpyrrol-3-yl)methylamino]butanoate |
| SMILES | COC(=O)[C@@H](NCc1ccn(C)c1)C(C)C |
| InChI | InChI=1S/C12H20N2O2/c1-9(2)11(12(15)16-4)13-7-10-5-6-14(3)8-10/h5-6,8-9,11,13H,7H2,1-4H3/t11-/m0/s1 |
| InChIKey | LSZMSWFDLJHYPG-NSHDSACASA-N |
| XLogP | 1.31 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |