C14H15Cl3N2 — CID 66399461
2,4,6-trichloro-N-[(1-propylpyrrol-3-yl)methyl]aniline (PubChem CID 66399461) has the molecular formula C14H15Cl3N2 and a molecular weight of 317.65 g/mol. Its IUPAC name is 2,4,6-trichloro-N-[(1-propylpyrrol-3-yl)methyl]aniline.
| Compound Name | 2,4,6-trichloro-N-[(1-propylpyrrol-3-yl)methyl]aniline |
|---|---|
| PubChem CID | 66399461 |
| Molecular Formula | C14H15Cl3N2 |
| Molecular Weight | 317.65 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 2,4,6-trichloro-N-[(1-propylpyrrol-3-yl)methyl]aniline |
| SMILES | CCCn1ccc(CNc2c(Cl)cc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C14H15Cl3N2/c1-2-4-19-5-3-10(9-19)8-18-14-12(16)6-11(15)7-13(14)17/h3,5-7,9,18H,2,4,8H2,1H3 |
| InChIKey | VLBDGRGSJKKCCT-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.65 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |