C14H24N4O3 — CID 66400704
2-[2-[(2-methoxyethylamino)methyl]imidazol-1-yl]-N-(oxan-4-yl)acetamide (PubChem CID 66400704) has the molecular formula C14H24N4O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is 2-[2-[(2-methoxyethylamino)methyl]imidazol-1-yl]-N-(oxan-4-yl)acetamide.
| Compound Name | 2-[2-[(2-methoxyethylamino)methyl]imidazol-1-yl]-N-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 66400704 |
| Molecular Formula | C14H24N4O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 2-[2-[(2-methoxyethylamino)methyl]imidazol-1-yl]-N-(oxan-4-yl)acetamide |
| SMILES | COCCNCc1nccn1CC(=O)NC1CCOCC1 |
| InChI | InChI=1S/C14H24N4O3/c1-20-9-5-15-10-13-16-4-6-18(13)11-14(19)17-12-2-7-21-8-3-12/h4,6,12,15H,2-3,5,7-11H2,1H3,(H,17,19) |
| InChIKey | XUXQDWIXOKFBEK-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|