C15H25N3O3 — CID 66402639
2-[2-[(2-methoxyethylamino)methyl]pyrrol-1-yl]-N-(oxan-4-yl)acetamide (PubChem CID 66402639) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is 2-[2-[(2-methoxyethylamino)methyl]pyrrol-1-yl]-N-(oxan-4-yl)acetamide.
| Compound Name | 2-[2-[(2-methoxyethylamino)methyl]pyrrol-1-yl]-N-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 66402639 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 2-[2-[(2-methoxyethylamino)methyl]pyrrol-1-yl]-N-(oxan-4-yl)acetamide |
| SMILES | COCCNCc1cccn1CC(=O)NC1CCOCC1 |
| InChI | InChI=1S/C15H25N3O3/c1-20-10-6-16-11-14-3-2-7-18(14)12-15(19)17-13-4-8-21-9-5-13/h2-3,7,13,16H,4-6,8-12H2,1H3,(H,17,19) |
| InChIKey | ONBUKXHONBFGPF-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|