C14H20N4O2 — CID 66402636
N-[[1-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]pyrrol-2-yl]methyl]-2-methoxyethanamine (PubChem CID 66402636) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is N-[[1-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]pyrrol-2-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[1-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]pyrrol-2-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 66402636 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | N-[[1-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]pyrrol-2-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1cccn1Cc1nc(C2CC2)no1 |
| InChI | InChI=1S/C14H20N4O2/c1-19-8-6-15-9-12-3-2-7-18(12)10-13-16-14(17-20-13)11-4-5-11/h2-3,7,11,15H,4-6,8-10H2,1H3 |
| InChIKey | BKTCQRORKAAXOI-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 65.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|