C15H19BrN2O — CID 66404821
N-[[1-[(3-bromophenyl)methyl]pyrrol-3-yl]methyl]-2-methoxyethanamine (PubChem CID 66404821) has the molecular formula C15H19BrN2O and a molecular weight of 323.23 g/mol. Its IUPAC name is N-[[1-[(3-bromophenyl)methyl]pyrrol-3-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[1-[(3-bromophenyl)methyl]pyrrol-3-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 66404821 |
| Molecular Formula | C15H19BrN2O |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | N-[[1-[(3-bromophenyl)methyl]pyrrol-3-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1ccn(Cc2cccc(Br)c2)c1 |
| InChI | InChI=1S/C15H19BrN2O/c1-19-8-6-17-10-14-5-7-18(12-14)11-13-3-2-4-15(16)9-13/h2-5,7,9,12,17H,6,8,10-11H2,1H3 |
| InChIKey | OZDBJAJJJYAPAW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|