C11H19N3O — CID 66408410
2-[3-(aminomethyl)pyrrol-1-yl]-N,N-diethylacetamide (PubChem CID 66408410) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-[3-(aminomethyl)pyrrol-1-yl]-N,N-diethylacetamide.
| Compound Name | 2-[3-(aminomethyl)pyrrol-1-yl]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 66408410 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 2-[3-(aminomethyl)pyrrol-1-yl]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)Cn1ccc(CN)c1 |
| InChI | InChI=1S/C11H19N3O/c1-3-14(4-2)11(15)9-13-6-5-10(7-12)8-13/h5-6,8H,3-4,7,9,12H2,1-2H3 |
| InChIKey | BLMUNEHXGIWZPR-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |