C14H11Cl2N3 — CID 66416280
2,6-dichloro-N-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)aniline (PubChem CID 66416280) has the molecular formula C14H11Cl2N3 and a molecular weight of 292.17 g/mol. Its IUPAC name is 2,6-dichloro-N-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)aniline.
| Compound Name | 2,6-dichloro-N-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 66416280 |
| Molecular Formula | C14H11Cl2N3 |
| Molecular Weight | 292.17 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 2,6-dichloro-N-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)aniline |
| SMILES | Clc1cccc(Cl)c1NCc1c[nH]c2ncccc12 |
| InChI | InChI=1S/C14H11Cl2N3/c15-11-4-1-5-12(16)13(11)18-7-9-8-19-14-10(9)3-2-6-17-14/h1-6,8,18H,7H2,(H,17,19) |
| InChIKey | JVLZSINEPJQSPN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.17 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |