C14H10Cl2FN3 — CID 107572383
3,5-dichloro-4-fluoro-N-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)aniline (PubChem CID 107572383) has the molecular formula C14H10Cl2FN3 and a molecular weight of 310.16 g/mol. Its IUPAC name is 3,5-dichloro-4-fluoro-N-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)aniline.
| Compound Name | 3,5-dichloro-4-fluoro-N-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 107572383 |
| Molecular Formula | C14H10Cl2FN3 |
| Molecular Weight | 310.16 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 3,5-dichloro-4-fluoro-N-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)aniline |
| SMILES | Fc1c(Cl)cc(NCc2c[nH]c3ncccc23)cc1Cl |
| InChI | InChI=1S/C14H10Cl2FN3/c15-11-4-9(5-12(16)13(11)17)19-6-8-7-20-14-10(8)2-1-3-18-14/h1-5,7,19H,6H2,(H,18,20) |
| InChIKey | HXGYXOGRWJFKSA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.16 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|