C15H10Cl3FN2 — CID 107572650
3,5-dichloro-N-[(6-chloro-1H-indol-3-yl)methyl]-4-fluoroaniline (PubChem CID 107572650) has the molecular formula C15H10Cl3FN2 and a molecular weight of 343.62 g/mol. Its IUPAC name is 3,5-dichloro-N-[(6-chloro-1H-indol-3-yl)methyl]-4-fluoroaniline.
| Compound Name | 3,5-dichloro-N-[(6-chloro-1H-indol-3-yl)methyl]-4-fluoroaniline |
|---|---|
| PubChem CID | 107572650 |
| Molecular Formula | C15H10Cl3FN2 |
| Molecular Weight | 343.62 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | 3,5-dichloro-N-[(6-chloro-1H-indol-3-yl)methyl]-4-fluoroaniline |
| SMILES | Fc1c(Cl)cc(NCc2c[nH]c3cc(Cl)ccc23)cc1Cl |
| InChI | InChI=1S/C15H10Cl3FN2/c16-9-1-2-11-8(7-21-14(11)3-9)6-20-10-4-12(17)15(19)13(18)5-10/h1-5,7,20-21H,6H2 |
| InChIKey | JNFPSYUFHHICAO-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.62 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|