C25H23N3O5 — CID 6641822
(2R,10R)-2-(2-hydroxy-3-prop-2-enylphenyl)-6,13-dimethyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),3(8),5-triene-4,7,12,14-tetrone (PubChem CID 6641822) has the molecular formula C25H23N3O5 and a molecular weight of 445.48 g/mol. Its IUPAC name is (2R,10R)-2-(2-hydroxy-3-prop-2-enylphenyl)-6,13-dimethyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),3(8),5-triene-4,7,12,14-tetrone.
| Compound Name | (2R,10R)-2-(2-hydroxy-3-prop-2-enylphenyl)-6,13-dimethyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),3(8),5-triene-4,7,12,14-tetrone |
|---|---|
| PubChem CID | 6641822 |
| Molecular Formula | C25H23N3O5 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | (2R,10R)-2-(2-hydroxy-3-prop-2-enylphenyl)-6,13-dimethyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),3(8),5-triene-4,7,12,14-tetrone |
| SMILES | C=CCc1cccc([C@H]2C3=CCn4c(=O)n(C)c(=O)n4[C@@H]3CC3=C2C(=O)C=C(C)C3=O)c1O |
| InChI | InChI=1S/C25H23N3O5/c1-4-6-14-7-5-8-16(23(14)31)20-15-9-10-27-24(32)26(3)25(33)28(27)18(15)12-17-21(20)19(29)11-13(2)22(17)30/h4-5,7-9,11,18,20,31H,1,6,10,12H2,2-3H3/t18-,20-/m1/s1 |
| InChIKey | BUZJIBVWPLASEV-UYAOXDASSA-N |
| XLogP | 1.85 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|