C17H18N4 — CID 66418255
2-[[[4-(1H-pyrazol-5-yl)phenyl]methylamino]methyl]aniline (PubChem CID 66418255) has the molecular formula C17H18N4 and a molecular weight of 278.36 g/mol. Its IUPAC name is 2-[[[4-(1H-pyrazol-5-yl)phenyl]methylamino]methyl]aniline.
| Compound Name | 2-[[[4-(1H-pyrazol-5-yl)phenyl]methylamino]methyl]aniline |
|---|---|
| PubChem CID | 66418255 |
| Molecular Formula | C17H18N4 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 2-[[[4-(1H-pyrazol-5-yl)phenyl]methylamino]methyl]aniline |
| SMILES | Nc1ccccc1CNCc1ccc(-c2ccn[nH]2)cc1 |
| InChI | InChI=1S/C17H18N4/c18-16-4-2-1-3-15(16)12-19-11-13-5-7-14(8-6-13)17-9-10-20-21-17/h1-10,19H,11-12,18H2,(H,20,21) |
| InChIKey | DMPOKDOALJFHIR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|