C14H19N3O2 — CID 63696732
2,2-dimethoxy-N-[[4-(1H-pyrazol-5-yl)phenyl]methyl]ethanamine (PubChem CID 63696732) has the molecular formula C14H19N3O2 and a molecular weight of 261.33 g/mol. Its IUPAC name is 2,2-dimethoxy-N-[[4-(1H-pyrazol-5-yl)phenyl]methyl]ethanamine.
| Compound Name | 2,2-dimethoxy-N-[[4-(1H-pyrazol-5-yl)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 63696732 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 2,2-dimethoxy-N-[[4-(1H-pyrazol-5-yl)phenyl]methyl]ethanamine |
| SMILES | COC(CNCc1ccc(-c2ccn[nH]2)cc1)OC |
| InChI | InChI=1S/C14H19N3O2/c1-18-14(19-2)10-15-9-11-3-5-12(6-4-11)13-7-8-16-17-13/h3-8,14-15H,9-10H2,1-2H3,(H,16,17) |
| InChIKey | NRTMVVXJMXCTBC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|