C13H17N3O2 — CID 63697596
N-(2,2-dimethoxyethyl)-4-(1H-pyrazol-5-yl)aniline (PubChem CID 63697596) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-4-(1H-pyrazol-5-yl)aniline.
| Compound Name | N-(2,2-dimethoxyethyl)-4-(1H-pyrazol-5-yl)aniline |
|---|---|
| PubChem CID | 63697596 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-4-(1H-pyrazol-5-yl)aniline |
| SMILES | COC(CNc1ccc(-c2ccn[nH]2)cc1)OC |
| InChI | InChI=1S/C13H17N3O2/c1-17-13(18-2)9-14-11-5-3-10(4-6-11)12-7-8-15-16-12/h3-8,13-14H,9H2,1-2H3,(H,15,16) |
| InChIKey | UHULWWQIEHUGFU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|