C10H16N2O2 — CID 60663243
2,2-dimethoxy-N-(pyridin-4-ylmethyl)ethanamine (PubChem CID 60663243) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 2,2-dimethoxy-N-(pyridin-4-ylmethyl)ethanamine.
| Compound Name | 2,2-dimethoxy-N-(pyridin-4-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 60663243 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 2,2-dimethoxy-N-(pyridin-4-ylmethyl)ethanamine |
| SMILES | COC(CNCc1ccncc1)OC |
| InChI | InChI=1S/C10H16N2O2/c1-13-10(14-2)8-12-7-9-3-5-11-6-4-9/h3-6,10,12H,7-8H2,1-2H3 |
| InChIKey | IWPXKQCAWYOCJG-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|