C20H29N7O — CID 664190
4,6,7-trimethyl-N-[3-(2-morpholin-4-ylethyl)-2,4-dihydro-1H-1,3,5-triazin-6-yl]quinazolin-2-amine (PubChem CID 664190) has the molecular formula C20H29N7O and a molecular weight of 383.50 g/mol. Its IUPAC name is 4,6,7-trimethyl-N-[3-(2-morpholin-4-ylethyl)-2,4-dihydro-1H-1,3,5-triazin-6-yl]quinazolin-2-amine.
| Compound Name | 4,6,7-trimethyl-N-[3-(2-morpholin-4-ylethyl)-2,4-dihydro-1H-1,3,5-triazin-6-yl]quinazolin-2-amine |
|---|---|
| PubChem CID | 664190 |
| Molecular Formula | C20H29N7O |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | 4,6,7-trimethyl-N-[3-(2-morpholin-4-ylethyl)-2,4-dihydro-1H-1,3,5-triazin-6-yl]quinazolin-2-amine |
| SMILES | Cc1cc2nc(NC3=NCN(CCN4CCOCC4)CN3)nc(C)c2cc1C |
| InChI | InChI=1S/C20H29N7O/c1-14-10-17-16(3)23-20(24-18(17)11-15(14)2)25-19-21-12-27(13-22-19)5-4-26-6-8-28-9-7-26/h10-11H,4-9,12-13H2,1-3H3,(H2,21,22,23,24,25) |
| InChIKey | POHLKNHAGYFGMU-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 77.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |