C16H15NO4 — CID 66419727
[3-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethoxy)-4-nitrophenyl]methanol (PubChem CID 66419727) has the molecular formula C16H15NO4 and a molecular weight of 285.30 g/mol. Its IUPAC name is [3-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethoxy)-4-nitrophenyl]methanol.
| Compound Name | [3-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethoxy)-4-nitrophenyl]methanol |
|---|---|
| PubChem CID | 66419727 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | [3-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethoxy)-4-nitrophenyl]methanol |
| SMILES | O=[N+]([O-])c1ccc(CO)cc1OCC1Cc2ccccc21 |
| InChI | InChI=1S/C16H15NO4/c18-9-11-5-6-15(17(19)20)16(7-11)21-10-13-8-12-3-1-2-4-14(12)13/h1-7,13,18H,8-10H2 |
| InChIKey | HAJGLAIQNFWEJL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|