C12H23NO2S — CID 66421985
2-[4-(3-methylpentan-2-yl)thiomorpholin-3-yl]acetic acid (PubChem CID 66421985) has the molecular formula C12H23NO2S and a molecular weight of 245.39 g/mol. Its IUPAC name is 2-[4-(3-methylpentan-2-yl)thiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[4-(3-methylpentan-2-yl)thiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 66421985 |
| Molecular Formula | C12H23NO2S |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 2-[4-(3-methylpentan-2-yl)thiomorpholin-3-yl]acetic acid |
| SMILES | CCC(C)C(C)N1CCSCC1CC(=O)O |
| InChI | InChI=1S/C12H23NO2S/c1-4-9(2)10(3)13-5-6-16-8-11(13)7-12(14)15/h9-11H,4-8H2,1-3H3,(H,14,15) |
| InChIKey | DPRXKDYEAOEIRF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |