C6H5ClN2O4 — CID 66423960
2-(5-chloro-2,4-dioxopyrimidin-1-yl)acetic acid (PubChem CID 66423960) has the molecular formula C6H5ClN2O4 and a molecular weight of 204.57 g/mol. Its IUPAC name is 2-(5-chloro-2,4-dioxopyrimidin-1-yl)acetic acid.
| Compound Name | 2-(5-chloro-2,4-dioxopyrimidin-1-yl)acetic acid |
|---|---|
| PubChem CID | 66423960 |
| Molecular Formula | C6H5ClN2O4 |
| Molecular Weight | 204.57 g/mol |
| Exact Mass | 203.99 |
| IUPAC Name | 2-(5-chloro-2,4-dioxopyrimidin-1-yl)acetic acid |
| SMILES | O=C(O)Cn1cc(Cl)c(=O)[nH]c1=O |
| InChI | InChI=1S/C6H5ClN2O4/c7-3-1-9(2-4(10)11)6(13)8-5(3)12/h1H,2H2,(H,10,11)(H,8,12,13) |
| InChIKey | PLXFGFUJNILRLI-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.57 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |