C11H18ClN3OS — CID 66427355
4-amino-3-[(5-chlorothiophen-2-yl)methyl-methylamino]-N-methylbutanamide (PubChem CID 66427355) has the molecular formula C11H18ClN3OS and a molecular weight of 275.81 g/mol. Its IUPAC name is 4-amino-3-[(5-chlorothiophen-2-yl)methyl-methylamino]-N-methylbutanamide.
| Compound Name | 4-amino-3-[(5-chlorothiophen-2-yl)methyl-methylamino]-N-methylbutanamide |
|---|---|
| PubChem CID | 66427355 |
| Molecular Formula | C11H18ClN3OS |
| Molecular Weight | 275.81 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 4-amino-3-[(5-chlorothiophen-2-yl)methyl-methylamino]-N-methylbutanamide |
| SMILES | CNC(=O)CC(CN)N(C)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C11H18ClN3OS/c1-14-11(16)5-8(6-13)15(2)7-9-3-4-10(12)17-9/h3-4,8H,5-7,13H2,1-2H3,(H,14,16) |
| InChIKey | HZYXANWAVOPNEO-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.81 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |