C8H14F3N3O2 — CID 66427817
N'-ethyl-2-(2,2,2-trifluoroethylamino)butanediamide (PubChem CID 66427817) has the molecular formula C8H14F3N3O2 and a molecular weight of 241.21 g/mol. Its IUPAC name is N'-ethyl-2-(2,2,2-trifluoroethylamino)butanediamide.
| Compound Name | N'-ethyl-2-(2,2,2-trifluoroethylamino)butanediamide |
|---|---|
| PubChem CID | 66427817 |
| Molecular Formula | C8H14F3N3O2 |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | N'-ethyl-2-(2,2,2-trifluoroethylamino)butanediamide |
| SMILES | CCNC(=O)CC(NCC(F)(F)F)C(N)=O |
| InChI | InChI=1S/C8H14F3N3O2/c1-2-13-6(15)3-5(7(12)16)14-4-8(9,10)11/h5,14H,2-4H2,1H3,(H2,12,16)(H,13,15) |
| InChIKey | LWPMXASSJGCUMF-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |