C9H18F3N3O — CID 66429516
4-amino-N-propyl-3-(2,2,2-trifluoroethylamino)butanamide (PubChem CID 66429516) has the molecular formula C9H18F3N3O and a molecular weight of 241.26 g/mol. Its IUPAC name is 4-amino-N-propyl-3-(2,2,2-trifluoroethylamino)butanamide.
| Compound Name | 4-amino-N-propyl-3-(2,2,2-trifluoroethylamino)butanamide |
|---|---|
| PubChem CID | 66429516 |
| Molecular Formula | C9H18F3N3O |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 4-amino-N-propyl-3-(2,2,2-trifluoroethylamino)butanamide |
| SMILES | CCCNC(=O)CC(CN)NCC(F)(F)F |
| InChI | InChI=1S/C9H18F3N3O/c1-2-3-14-8(16)4-7(5-13)15-6-9(10,11)12/h7,15H,2-6,13H2,1H3,(H,14,16) |
| InChIKey | BRANKNYTFLZPOG-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |