C12H16BrN3O4S — CID 66428260
N-(2-bromo-4-sulfamoylphenyl)-2-morpholin-2-ylacetamide (PubChem CID 66428260) has the molecular formula C12H16BrN3O4S and a molecular weight of 378.25 g/mol. Its IUPAC name is N-(2-bromo-4-sulfamoylphenyl)-2-morpholin-2-ylacetamide.
| Compound Name | N-(2-bromo-4-sulfamoylphenyl)-2-morpholin-2-ylacetamide |
|---|---|
| PubChem CID | 66428260 |
| Molecular Formula | C12H16BrN3O4S |
| Molecular Weight | 378.25 g/mol |
| Exact Mass | 377.00 |
| IUPAC Name | N-(2-bromo-4-sulfamoylphenyl)-2-morpholin-2-ylacetamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)CC2CNCCO2)c(Br)c1 |
| InChI | InChI=1S/C12H16BrN3O4S/c13-10-6-9(21(14,18)19)1-2-11(10)16-12(17)5-8-7-15-3-4-20-8/h1-2,6,8,15H,3-5,7H2,(H,16,17)(H2,14,18,19) |
| InChIKey | OXVIPFAMTHNIFP-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.25 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |