C13H16FN3O2 — CID 66429998
N'-cyclopropyl-2-(2-fluoroanilino)butanediamide (PubChem CID 66429998) has the molecular formula C13H16FN3O2 and a molecular weight of 265.29 g/mol. Its IUPAC name is N'-cyclopropyl-2-(2-fluoroanilino)butanediamide.
| Compound Name | N'-cyclopropyl-2-(2-fluoroanilino)butanediamide |
|---|---|
| PubChem CID | 66429998 |
| Molecular Formula | C13H16FN3O2 |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | N'-cyclopropyl-2-(2-fluoroanilino)butanediamide |
| SMILES | NC(=O)C(CC(=O)NC1CC1)Nc1ccccc1F |
| InChI | InChI=1S/C13H16FN3O2/c14-9-3-1-2-4-10(9)17-11(13(15)19)7-12(18)16-8-5-6-8/h1-4,8,11,17H,5-7H2,(H2,15,19)(H,16,18) |
| InChIKey | NUIZZQJQLGDRKP-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |