C12H23N3O2 — CID 66430872
2-(cyclopropylmethylamino)-N',N'-diethylbutanediamide (PubChem CID 66430872) has the molecular formula C12H23N3O2 and a molecular weight of 241.33 g/mol. Its IUPAC name is 2-(cyclopropylmethylamino)-N',N'-diethylbutanediamide.
| Compound Name | 2-(cyclopropylmethylamino)-N',N'-diethylbutanediamide |
|---|---|
| PubChem CID | 66430872 |
| Molecular Formula | C12H23N3O2 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 2-(cyclopropylmethylamino)-N',N'-diethylbutanediamide |
| SMILES | CCN(CC)C(=O)CC(NCC1CC1)C(N)=O |
| InChI | InChI=1S/C12H23N3O2/c1-3-15(4-2)11(16)7-10(12(13)17)14-8-9-5-6-9/h9-10,14H,3-8H2,1-2H3,(H2,13,17) |
| InChIKey | SBYVCIWBYGCYLW-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |