C12H19N3O3 — CID 66435007
2-[[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]methyl]morpholine (PubChem CID 66435007) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-[[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]methyl]morpholine.
| Compound Name | 2-[[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]methyl]morpholine |
|---|---|
| PubChem CID | 66435007 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 2-[[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]methyl]morpholine |
| SMILES | C1COC(Cc2nc(C3CCOCC3)no2)CN1 |
| InChI | InChI=1S/C12H19N3O3/c1-4-16-5-2-9(1)12-14-11(18-15-12)7-10-8-13-3-6-17-10/h9-10,13H,1-8H2 |
| InChIKey | HSESLRFBUXPOTR-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |