C9H15N3O2 — CID 66434031
2-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]morpholine (PubChem CID 66434031) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 2-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]morpholine.
| Compound Name | 2-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]morpholine |
|---|---|
| PubChem CID | 66434031 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 2-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]morpholine |
| SMILES | CCc1noc(CC2CNCCO2)n1 |
| InChI | InChI=1S/C9H15N3O2/c1-2-8-11-9(14-12-8)5-7-6-10-3-4-13-7/h7,10H,2-6H2,1H3 |
| InChIKey | MAGSALDFIBPUPB-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |