C13H13Cl2N3O2 — CID 104880695
2-[[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]morpholine (PubChem CID 104880695) has the molecular formula C13H13Cl2N3O2 and a molecular weight of 314.17 g/mol. Its IUPAC name is 2-[[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]morpholine.
| Compound Name | 2-[[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]morpholine |
|---|---|
| PubChem CID | 104880695 |
| Molecular Formula | C13H13Cl2N3O2 |
| Molecular Weight | 314.17 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 2-[[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]morpholine |
| SMILES | Clc1cc(Cl)cc(-c2noc(CC3CNCCO3)n2)c1 |
| InChI | InChI=1S/C13H13Cl2N3O2/c14-9-3-8(4-10(15)5-9)13-17-12(20-18-13)6-11-7-16-1-2-19-11/h3-5,11,16H,1-2,6-7H2 |
| InChIKey | WZCANWSCYQGVGO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.17 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |