About 2-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]morpholine
2-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]morpholine (PubChem CID 66434034) has the molecular formula C13H14N4O4
and a molecular weight of 290.28 g/mol. Its IUPAC name is 2-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]morpholine.
Molecular Properties
| Compound Name | 2-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]morpholine |
| PubChem CID | 66434034 |
| Molecular Formula | C13H14N4O4 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 2-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]morpholine |
| SMILES | O=[N+]([O-])c1ccc(-c2noc(CC3CNCCO3)n2)cc1 |
| InChI | InChI=1S/C13H14N4O4/c18-17(19)10-3-1-9(2-4-10)13-15-12(21-16-13)7-11-8-14-5-6-20-11/h1-4,11,14H,5-8H2 |
| InChIKey | BQLFAUUVMSHHTM-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]morpholine?
The IUPAC name of 2-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]morpholine (CID 66434034) is 2-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]morpholine.
What is the SMILES notation for 2-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]morpholine?
The canonical SMILES for 2-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]morpholine is O=[N+]([O-])c1ccc(-c2noc(CC3CNCCO3)n2)cc1.
What is the InChIKey of 2-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]morpholine?
The InChIKey is BQLFAUUVMSHHTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4O4/c18-17(19)10-3-1-9(2-4-10)13-15-12(21-16-13)7-11-8-14-5-6-20-11/h1-4,11,14H,5-8H2.
What are the key properties of 2-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]morpholine?
2-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]morpholine has a molecular weight of 290.28 g/mol, XLogP of 1.18, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]morpholine is sourced from PubChem (CID 66434034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).