C14H22ClN — CID 66436507
2-(4-chlorophenyl)-N-(2-methylpropyl)butan-1-amine (PubChem CID 66436507) has the molecular formula C14H22ClN and a molecular weight of 239.79 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-(2-methylpropyl)butan-1-amine.
| Compound Name | 2-(4-chlorophenyl)-N-(2-methylpropyl)butan-1-amine |
|---|---|
| PubChem CID | 66436507 |
| Molecular Formula | C14H22ClN |
| Molecular Weight | 239.79 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 2-(4-chlorophenyl)-N-(2-methylpropyl)butan-1-amine |
| SMILES | CCC(CNCC(C)C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H22ClN/c1-4-12(10-16-9-11(2)3)13-5-7-14(15)8-6-13/h5-8,11-12,16H,4,9-10H2,1-3H3 |
| InChIKey | WIYGOFKHQGVPDV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.79 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |