C17H21BrClNS — CID 79432398
N-[3-(3-bromothiophen-2-yl)-2-(4-chlorophenyl)propyl]-2-methylpropan-1-amine (PubChem CID 79432398) has the molecular formula C17H21BrClNS and a molecular weight of 386.79 g/mol. Its IUPAC name is N-[3-(3-bromothiophen-2-yl)-2-(4-chlorophenyl)propyl]-2-methylpropan-1-amine.
| Compound Name | N-[3-(3-bromothiophen-2-yl)-2-(4-chlorophenyl)propyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 79432398 |
| Molecular Formula | C17H21BrClNS |
| Molecular Weight | 386.79 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | N-[3-(3-bromothiophen-2-yl)-2-(4-chlorophenyl)propyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCC(Cc1sccc1Br)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H21BrClNS/c1-12(2)10-20-11-14(9-17-16(18)7-8-21-17)13-3-5-15(19)6-4-13/h3-8,12,14,20H,9-11H2,1-2H3 |
| InChIKey | WYADKRVJYUDUHN-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.79 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |