C13H16O5S — CID 66436518
methyl 2,3-dimethyl-3-(4-methylsulfonylphenyl)oxirane-2-carboxylate (PubChem CID 66436518) has the molecular formula C13H16O5S and a molecular weight of 284.33 g/mol. Its IUPAC name is methyl 2,3-dimethyl-3-(4-methylsulfonylphenyl)oxirane-2-carboxylate.
| Compound Name | methyl 2,3-dimethyl-3-(4-methylsulfonylphenyl)oxirane-2-carboxylate |
|---|---|
| PubChem CID | 66436518 |
| Molecular Formula | C13H16O5S |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | methyl 2,3-dimethyl-3-(4-methylsulfonylphenyl)oxirane-2-carboxylate |
| SMILES | COC(=O)C1(C)OC1(C)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C13H16O5S/c1-12(13(2,18-12)11(14)17-3)9-5-7-10(8-6-9)19(4,15)16/h5-8H,1-4H3 |
| InChIKey | RIHFLEPWPAOEJQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 72.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|