C10H16N2O — CID 66436592
(5-cyclopropyl-1-propan-2-ylpyrazol-4-yl)methanol (PubChem CID 66436592) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is (5-cyclopropyl-1-propan-2-ylpyrazol-4-yl)methanol.
| Compound Name | (5-cyclopropyl-1-propan-2-ylpyrazol-4-yl)methanol |
|---|---|
| PubChem CID | 66436592 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | (5-cyclopropyl-1-propan-2-ylpyrazol-4-yl)methanol |
| SMILES | CC(C)n1ncc(CO)c1C1CC1 |
| InChI | InChI=1S/C10H16N2O/c1-7(2)12-10(8-3-4-8)9(6-13)5-11-12/h5,7-8,13H,3-4,6H2,1-2H3 |
| InChIKey | QISCQIBFVWLQDR-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |