C12H16N4O3S — CID 66443588
2-[4-[2-oxo-2-(pyrimidin-2-ylamino)ethyl]thiomorpholin-3-yl]acetic acid (PubChem CID 66443588) has the molecular formula C12H16N4O3S and a molecular weight of 296.35 g/mol. Its IUPAC name is 2-[4-[2-oxo-2-(pyrimidin-2-ylamino)ethyl]thiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[4-[2-oxo-2-(pyrimidin-2-ylamino)ethyl]thiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 66443588 |
| Molecular Formula | C12H16N4O3S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 2-[4-[2-oxo-2-(pyrimidin-2-ylamino)ethyl]thiomorpholin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CSCCN1CC(=O)Nc1ncccn1 |
| InChI | InChI=1S/C12H16N4O3S/c17-10(15-12-13-2-1-3-14-12)7-16-4-5-20-8-9(16)6-11(18)19/h1-3,9H,4-8H2,(H,18,19)(H,13,14,15,17) |
| InChIKey | UJVRNMWBCASNKS-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |