C13H23N3O3S — CID 66445327
2-[4-[3-(cyclopropylamino)propylcarbamoyl]thiomorpholin-3-yl]acetic acid (PubChem CID 66445327) has the molecular formula C13H23N3O3S and a molecular weight of 301.41 g/mol. Its IUPAC name is 2-[4-[3-(cyclopropylamino)propylcarbamoyl]thiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[4-[3-(cyclopropylamino)propylcarbamoyl]thiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 66445327 |
| Molecular Formula | C13H23N3O3S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 2-[4-[3-(cyclopropylamino)propylcarbamoyl]thiomorpholin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CSCCN1C(=O)NCCCNC1CC1 |
| InChI | InChI=1S/C13H23N3O3S/c17-12(18)8-11-9-20-7-6-16(11)13(19)15-5-1-4-14-10-2-3-10/h10-11,14H,1-9H2,(H,15,19)(H,17,18) |
| InChIKey | ADXLTHRQBXASDZ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|