C15H25N3O4S — CID 119210797
2-[4-[2-(cyclohexylcarbamoylamino)acetyl]thiomorpholin-3-yl]acetic acid (PubChem CID 119210797) has the molecular formula C15H25N3O4S and a molecular weight of 343.45 g/mol. Its IUPAC name is 2-[4-[2-(cyclohexylcarbamoylamino)acetyl]thiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[4-[2-(cyclohexylcarbamoylamino)acetyl]thiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 119210797 |
| Molecular Formula | C15H25N3O4S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 2-[4-[2-(cyclohexylcarbamoylamino)acetyl]thiomorpholin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CSCCN1C(=O)CNC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C15H25N3O4S/c19-13(18-6-7-23-10-12(18)8-14(20)21)9-16-15(22)17-11-4-2-1-3-5-11/h11-12H,1-10H2,(H,20,21)(H2,16,17,22) |
| InChIKey | HPFPOXVAXGNHPD-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |