About cyclopropylmethyl 2-thiomorpholin-3-ylacetate
cyclopropylmethyl 2-thiomorpholin-3-ylacetate (PubChem CID 66445671) has the molecular formula C10H17NO2S
and a molecular weight of 215.32 g/mol. Its IUPAC name is cyclopropylmethyl 2-thiomorpholin-3-ylacetate.
Molecular Properties
| Compound Name | cyclopropylmethyl 2-thiomorpholin-3-ylacetate |
| PubChem CID | 66445671 |
| Molecular Formula | C10H17NO2S |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | cyclopropylmethyl 2-thiomorpholin-3-ylacetate |
| SMILES | O=C(CC1CSCCN1)OCC1CC1 |
| InChI | InChI=1S/C10H17NO2S/c12-10(13-6-8-1-2-8)5-9-7-14-4-3-11-9/h8-9,11H,1-7H2 |
| InChIKey | WXNREYIIXKBPSU-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyclopropylmethyl 2-thiomorpholin-3-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropylmethyl 2-thiomorpholin-3-ylacetate?
The IUPAC name of cyclopropylmethyl 2-thiomorpholin-3-ylacetate (CID 66445671) is cyclopropylmethyl 2-thiomorpholin-3-ylacetate.
What is the SMILES notation for cyclopropylmethyl 2-thiomorpholin-3-ylacetate?
The canonical SMILES for cyclopropylmethyl 2-thiomorpholin-3-ylacetate is O=C(CC1CSCCN1)OCC1CC1.
What is the InChIKey of cyclopropylmethyl 2-thiomorpholin-3-ylacetate?
The InChIKey is WXNREYIIXKBPSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2S/c12-10(13-6-8-1-2-8)5-9-7-14-4-3-11-9/h8-9,11H,1-7H2.
What are the key properties of cyclopropylmethyl 2-thiomorpholin-3-ylacetate?
cyclopropylmethyl 2-thiomorpholin-3-ylacetate has a molecular weight of 215.32 g/mol, XLogP of 1.03, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropylmethyl 2-thiomorpholin-3-ylacetate is sourced from PubChem (CID 66445671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).