C12H8F2N2O2S — CID 66449006
methyl 6-(2,4-difluorophenyl)sulfanylpyrazine-2-carboxylate (PubChem CID 66449006) has the molecular formula C12H8F2N2O2S and a molecular weight of 282.27 g/mol. Its IUPAC name is methyl 6-(2,4-difluorophenyl)sulfanylpyrazine-2-carboxylate.
| Compound Name | methyl 6-(2,4-difluorophenyl)sulfanylpyrazine-2-carboxylate |
|---|---|
| PubChem CID | 66449006 |
| Molecular Formula | C12H8F2N2O2S |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | methyl 6-(2,4-difluorophenyl)sulfanylpyrazine-2-carboxylate |
| SMILES | COC(=O)c1cncc(Sc2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C12H8F2N2O2S/c1-18-12(17)9-5-15-6-11(16-9)19-10-3-2-7(13)4-8(10)14/h2-6H,1H3 |
| InChIKey | POTQMLLKQFDWOQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |