C14H16BrNO — CID 66453095
2-[2-bromo-2-(2,4,5-trimethylfuran-3-yl)ethyl]pyridine (PubChem CID 66453095) has the molecular formula C14H16BrNO and a molecular weight of 294.19 g/mol. Its IUPAC name is 2-[2-bromo-2-(2,4,5-trimethylfuran-3-yl)ethyl]pyridine.
| Compound Name | 2-[2-bromo-2-(2,4,5-trimethylfuran-3-yl)ethyl]pyridine |
|---|---|
| PubChem CID | 66453095 |
| Molecular Formula | C14H16BrNO |
| Molecular Weight | 294.19 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 2-[2-bromo-2-(2,4,5-trimethylfuran-3-yl)ethyl]pyridine |
| SMILES | Cc1oc(C)c(C(Br)Cc2ccccn2)c1C |
| InChI | InChI=1S/C14H16BrNO/c1-9-10(2)17-11(3)14(9)13(15)8-12-6-4-5-7-16-12/h4-7,13H,8H2,1-3H3 |
| InChIKey | NQXVFRFZJRADHH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.19 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|