C16H18BrNO2 — CID 66453117
2-[2-bromo-2-(2,5-dimethoxyphenyl)ethyl]-3-methylpyridine (PubChem CID 66453117) has the molecular formula C16H18BrNO2 and a molecular weight of 336.23 g/mol. Its IUPAC name is 2-[2-bromo-2-(2,5-dimethoxyphenyl)ethyl]-3-methylpyridine.
| Compound Name | 2-[2-bromo-2-(2,5-dimethoxyphenyl)ethyl]-3-methylpyridine |
|---|---|
| PubChem CID | 66453117 |
| Molecular Formula | C16H18BrNO2 |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 2-[2-bromo-2-(2,5-dimethoxyphenyl)ethyl]-3-methylpyridine |
| SMILES | COc1ccc(OC)c(C(Br)Cc2ncccc2C)c1 |
| InChI | InChI=1S/C16H18BrNO2/c1-11-5-4-8-18-15(11)10-14(17)13-9-12(19-2)6-7-16(13)20-3/h4-9,14H,10H2,1-3H3 |
| InChIKey | BDJIAUCEGDXIAK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|