C13H25NO — CID 66453368
4-[cyclopentyl(ethyl)amino]-3,3-dimethylbutan-2-one (PubChem CID 66453368) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is 4-[cyclopentyl(ethyl)amino]-3,3-dimethylbutan-2-one.
| Compound Name | 4-[cyclopentyl(ethyl)amino]-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 66453368 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | 4-[cyclopentyl(ethyl)amino]-3,3-dimethylbutan-2-one |
| SMILES | CCN(CC(C)(C)C(C)=O)C1CCCC1 |
| InChI | InChI=1S/C13H25NO/c1-5-14(12-8-6-7-9-12)10-13(3,4)11(2)15/h12H,5-10H2,1-4H3 |
| InChIKey | HPYOSRDISYQLDN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |