C16H18BrNO3 — CID 66454195
4-[2-bromo-2-(2,4,5-trimethoxyphenyl)ethyl]pyridine (PubChem CID 66454195) has the molecular formula C16H18BrNO3 and a molecular weight of 352.23 g/mol. Its IUPAC name is 4-[2-bromo-2-(2,4,5-trimethoxyphenyl)ethyl]pyridine.
| Compound Name | 4-[2-bromo-2-(2,4,5-trimethoxyphenyl)ethyl]pyridine |
|---|---|
| PubChem CID | 66454195 |
| Molecular Formula | C16H18BrNO3 |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 4-[2-bromo-2-(2,4,5-trimethoxyphenyl)ethyl]pyridine |
| SMILES | COc1cc(OC)c(C(Br)Cc2ccncc2)cc1OC |
| InChI | InChI=1S/C16H18BrNO3/c1-19-14-10-16(21-3)15(20-2)9-12(14)13(17)8-11-4-6-18-7-5-11/h4-7,9-10,13H,8H2,1-3H3 |
| InChIKey | YYFOQFSMLKYKDG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|