methyl 6-(4,5-dimethylimidazol-1-yl)pyrazine-2-carboxylate

C11H12N4O2 — CID 66455880

IUPACmethyl 6-(4,5-dimethylimidazol-1-yl)pyrazine-2-carboxylate
SMILESCOC(=O)c1cncc(-n2cnc(C)c2C)n1
InChIInChI=1S/C11H12N4O2/c1-7-8(2)15(6-13-7)10-5-12-4-9(14-10)11(16)17-3/h4-6H,1-3H3
InChIKeyXHILANINJRXKPA-UHFFFAOYSA-N
MW232.24 g/mol
LogP1.07
Rot. Bonds2

About methyl 6-(4,5-dimethylimidazol-1-yl)pyrazine-2-carboxylate

methyl 6-(4,5-dimethylimidazol-1-yl)pyrazine-2-carboxylate (PubChem CID 66455880) has the molecular formula C11H12N4O2 and a molecular weight of 232.24 g/mol. Its IUPAC name is methyl 6-(4,5-dimethylimidazol-1-yl)pyrazine-2-carboxylate.

Molecular Properties

Compound Namemethyl 6-(4,5-dimethylimidazol-1-yl)pyrazine-2-carboxylate
PubChem CID66455880
Molecular FormulaC11H12N4O2
Molecular Weight232.24 g/mol
Exact Mass232.10
IUPAC Namemethyl 6-(4,5-dimethylimidazol-1-yl)pyrazine-2-carboxylate
SMILESCOC(=O)c1cncc(-n2cnc(C)c2C)n1
InChIInChI=1S/C11H12N4O2/c1-7-8(2)15(6-13-7)10-5-12-4-9(14-10)11(16)17-3/h4-6H,1-3H3
InChIKeyXHILANINJRXKPA-UHFFFAOYSA-N
XLogP1.07
TPSA69.90 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.24
LogP ≤ 51.07
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze methyl 6-(4,5-dimethylimidazol-1-yl)pyrazine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 6-(4,5-dimethylimidazol-1-yl)pyrazine-2-carboxylate?
The IUPAC name of methyl 6-(4,5-dimethylimidazol-1-yl)pyrazine-2-carboxylate (CID 66455880) is methyl 6-(4,5-dimethylimidazol-1-yl)pyrazine-2-carboxylate.
What is the SMILES notation for methyl 6-(4,5-dimethylimidazol-1-yl)pyrazine-2-carboxylate?
The canonical SMILES for methyl 6-(4,5-dimethylimidazol-1-yl)pyrazine-2-carboxylate is COC(=O)c1cncc(-n2cnc(C)c2C)n1.
What is the InChIKey of methyl 6-(4,5-dimethylimidazol-1-yl)pyrazine-2-carboxylate?
The InChIKey is XHILANINJRXKPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4O2/c1-7-8(2)15(6-13-7)10-5-12-4-9(14-10)11(16)17-3/h4-6H,1-3H3.
What are the key properties of methyl 6-(4,5-dimethylimidazol-1-yl)pyrazine-2-carboxylate?
methyl 6-(4,5-dimethylimidazol-1-yl)pyrazine-2-carboxylate has a molecular weight of 232.24 g/mol, XLogP of 1.07, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-(4,5-dimethylimidazol-1-yl)pyrazine-2-carboxylate is sourced from PubChem (CID 66455880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).