methyl 6-(1,3,5-trimethylpyrazol-4-yl)oxypyrazine-2-carboxylate

C12H14N4O3 — CID 66458098

IUPACmethyl 6-(1,3,5-trimethylpyrazol-4-yl)oxypyrazine-2-carboxylate
SMILESCOC(=O)c1cncc(Oc2c(C)nn(C)c2C)n1
InChIInChI=1S/C12H14N4O3/c1-7-11(8(2)16(3)15-7)19-10-6-13-5-9(14-10)12(17)18-4/h5-6H,1-4H3
InChIKeyNMGIMUUNMSSLEE-UHFFFAOYSA-N
MW262.27 g/mol
LogP1.41
Rot. Bonds3

About methyl 6-(1,3,5-trimethylpyrazol-4-yl)oxypyrazine-2-carboxylate

methyl 6-(1,3,5-trimethylpyrazol-4-yl)oxypyrazine-2-carboxylate (PubChem CID 66458098) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is methyl 6-(1,3,5-trimethylpyrazol-4-yl)oxypyrazine-2-carboxylate.

Molecular Properties

Compound Namemethyl 6-(1,3,5-trimethylpyrazol-4-yl)oxypyrazine-2-carboxylate
PubChem CID66458098
Molecular FormulaC12H14N4O3
Molecular Weight262.27 g/mol
Exact Mass262.11
IUPAC Namemethyl 6-(1,3,5-trimethylpyrazol-4-yl)oxypyrazine-2-carboxylate
SMILESCOC(=O)c1cncc(Oc2c(C)nn(C)c2C)n1
InChIInChI=1S/C12H14N4O3/c1-7-11(8(2)16(3)15-7)19-10-6-13-5-9(14-10)12(17)18-4/h5-6H,1-4H3
InChIKeyNMGIMUUNMSSLEE-UHFFFAOYSA-N
XLogP1.41
TPSA79.13 Ų
H-Bond Donors
H-Bond Acceptors7
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.27
LogP ≤ 51.41
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 107

Analyze methyl 6-(1,3,5-trimethylpyrazol-4-yl)oxypyrazine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 6-(1,3,5-trimethylpyrazol-4-yl)oxypyrazine-2-carboxylate?
The IUPAC name of methyl 6-(1,3,5-trimethylpyrazol-4-yl)oxypyrazine-2-carboxylate (CID 66458098) is methyl 6-(1,3,5-trimethylpyrazol-4-yl)oxypyrazine-2-carboxylate.
What is the SMILES notation for methyl 6-(1,3,5-trimethylpyrazol-4-yl)oxypyrazine-2-carboxylate?
The canonical SMILES for methyl 6-(1,3,5-trimethylpyrazol-4-yl)oxypyrazine-2-carboxylate is COC(=O)c1cncc(Oc2c(C)nn(C)c2C)n1.
What is the InChIKey of methyl 6-(1,3,5-trimethylpyrazol-4-yl)oxypyrazine-2-carboxylate?
The InChIKey is NMGIMUUNMSSLEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O3/c1-7-11(8(2)16(3)15-7)19-10-6-13-5-9(14-10)12(17)18-4/h5-6H,1-4H3.
What are the key properties of methyl 6-(1,3,5-trimethylpyrazol-4-yl)oxypyrazine-2-carboxylate?
methyl 6-(1,3,5-trimethylpyrazol-4-yl)oxypyrazine-2-carboxylate has a molecular weight of 262.27 g/mol, XLogP of 1.41, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-(1,3,5-trimethylpyrazol-4-yl)oxypyrazine-2-carboxylate is sourced from PubChem (CID 66458098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).